C7HBr2F3N2O — CID 133096082
5,6-dibromo-4-(trifluoromethoxy)pyridine-3-carbonitrile (PubChem CID 133096082) has the molecular formula C7HBr2F3N2O and a molecular weight of 345.90 g/mol. Its IUPAC name is 5,6-dibromo-4-(trifluoromethoxy)pyridine-3-carbonitrile.
| Compound Name | 5,6-dibromo-4-(trifluoromethoxy)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 133096082 |
| Molecular Formula | C7HBr2F3N2O |
| Molecular Weight | 345.90 g/mol |
| Exact Mass | 343.84 |
| IUPAC Name | 5,6-dibromo-4-(trifluoromethoxy)pyridine-3-carbonitrile |
| SMILES | N#Cc1cnc(Br)c(Br)c1OC(F)(F)F |
| InChI | InChI=1S/C7HBr2F3N2O/c8-4-5(15-7(10,11)12)3(1-13)2-14-6(4)9/h2H |
| InChIKey | IALZMCRZGHDAOU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.90 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|