C8H6F3N3O — CID 119000736
6-amino-5-methyl-4-(trifluoromethoxy)pyridine-3-carbonitrile (PubChem CID 119000736) has the molecular formula C8H6F3N3O and a molecular weight of 217.15 g/mol. Its IUPAC name is 6-amino-5-methyl-4-(trifluoromethoxy)pyridine-3-carbonitrile.
| Compound Name | 6-amino-5-methyl-4-(trifluoromethoxy)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 119000736 |
| Molecular Formula | C8H6F3N3O |
| Molecular Weight | 217.15 g/mol |
| Exact Mass | 217.05 |
| IUPAC Name | 6-amino-5-methyl-4-(trifluoromethoxy)pyridine-3-carbonitrile |
| SMILES | Cc1c(N)ncc(C#N)c1OC(F)(F)F |
| InChI | InChI=1S/C8H6F3N3O/c1-4-6(15-8(9,10)11)5(2-12)3-14-7(4)13/h3H,1H3,(H2,13,14) |
| InChIKey | XTOGJTWYZYCFSO-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.15 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |