C6HBr3F3NO — CID 118809447
2,3,4-tribromo-5-(trifluoromethoxy)pyridine (PubChem CID 118809447) has the molecular formula C6HBr3F3NO and a molecular weight of 399.79 g/mol. Its IUPAC name is 2,3,4-tribromo-5-(trifluoromethoxy)pyridine.
| Compound Name | 2,3,4-tribromo-5-(trifluoromethoxy)pyridine |
|---|---|
| PubChem CID | 118809447 |
| Molecular Formula | C6HBr3F3NO |
| Molecular Weight | 399.79 g/mol |
| Exact Mass | 396.76 |
| IUPAC Name | 2,3,4-tribromo-5-(trifluoromethoxy)pyridine |
| SMILES | FC(F)(F)Oc1cnc(Br)c(Br)c1Br |
| InChI | InChI=1S/C6HBr3F3NO/c7-3-2(14-6(10,11)12)1-13-5(9)4(3)8/h1H |
| InChIKey | SBDYGGCRWRYVML-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.79 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|