C8H10F3N3O2 — CID 133086232
2-(aminomethyl)-5-methoxy-4-(trifluoromethoxy)pyridin-3-amine (PubChem CID 133086232) has the molecular formula C8H10F3N3O2 and a molecular weight of 237.18 g/mol. Its IUPAC name is 2-(aminomethyl)-5-methoxy-4-(trifluoromethoxy)pyridin-3-amine.
| Compound Name | 2-(aminomethyl)-5-methoxy-4-(trifluoromethoxy)pyridin-3-amine |
|---|---|
| PubChem CID | 133086232 |
| Molecular Formula | C8H10F3N3O2 |
| Molecular Weight | 237.18 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | 2-(aminomethyl)-5-methoxy-4-(trifluoromethoxy)pyridin-3-amine |
| SMILES | COc1cnc(CN)c(N)c1OC(F)(F)F |
| InChI | InChI=1S/C8H10F3N3O2/c1-15-5-3-14-4(2-12)6(13)7(5)16-8(9,10)11/h3H,2,12-13H2,1H3 |
| InChIKey | UEXXBHZYMQCWHV-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.18 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |