C9H8F6N2O2 — CID 134662772
[5-methoxy-4-(trifluoromethoxy)-2-(trifluoromethyl)-3-pyridinyl]methanamine (PubChem CID 134662772) has the molecular formula C9H8F6N2O2 and a molecular weight of 290.16 g/mol. Its IUPAC name is [5-methoxy-4-(trifluoromethoxy)-2-(trifluoromethyl)-3-pyridinyl]methanamine.
| Compound Name | [5-methoxy-4-(trifluoromethoxy)-2-(trifluoromethyl)-3-pyridinyl]methanamine |
|---|---|
| PubChem CID | 134662772 |
| Molecular Formula | C9H8F6N2O2 |
| Molecular Weight | 290.16 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | [5-methoxy-4-(trifluoromethoxy)-2-(trifluoromethyl)-3-pyridinyl]methanamine |
| SMILES | COc1cnc(C(F)(F)F)c(CN)c1OC(F)(F)F |
| InChI | InChI=1S/C9H8F6N2O2/c1-18-5-3-17-7(8(10,11)12)4(2-16)6(5)19-9(13,14)15/h3H,2,16H2,1H3 |
| InChIKey | MXXLZHSTUPJFFP-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.16 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |