C9H9F3N2O4 — CID 118848308
2-(aminomethyl)-5-methoxy-4-(trifluoromethoxy)pyridine-3-carboxylic acid (PubChem CID 118848308) has the molecular formula C9H9F3N2O4 and a molecular weight of 266.17 g/mol. Its IUPAC name is 2-(aminomethyl)-5-methoxy-4-(trifluoromethoxy)pyridine-3-carboxylic acid.
| Compound Name | 2-(aminomethyl)-5-methoxy-4-(trifluoromethoxy)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 118848308 |
| Molecular Formula | C9H9F3N2O4 |
| Molecular Weight | 266.17 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 2-(aminomethyl)-5-methoxy-4-(trifluoromethoxy)pyridine-3-carboxylic acid |
| SMILES | COc1cnc(CN)c(C(=O)O)c1OC(F)(F)F |
| InChI | InChI=1S/C9H9F3N2O4/c1-17-5-3-14-4(2-13)6(8(15)16)7(5)18-9(10,11)12/h3H,2,13H2,1H3,(H,15,16) |
| InChIKey | HNYDTWOAQNMBLL-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 94.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.17 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |