C11H10F6N2O3 — CID 134682897
ethyl 3-(aminomethyl)-5-(trifluoromethoxy)-2-(trifluoromethyl)pyridine-4-carboxylate (PubChem CID 134682897) has the molecular formula C11H10F6N2O3 and a molecular weight of 332.20 g/mol. Its IUPAC name is ethyl 3-(aminomethyl)-5-(trifluoromethoxy)-2-(trifluoromethyl)pyridine-4-carboxylate.
| Compound Name | ethyl 3-(aminomethyl)-5-(trifluoromethoxy)-2-(trifluoromethyl)pyridine-4-carboxylate |
|---|---|
| PubChem CID | 134682897 |
| Molecular Formula | C11H10F6N2O3 |
| Molecular Weight | 332.20 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | ethyl 3-(aminomethyl)-5-(trifluoromethoxy)-2-(trifluoromethyl)pyridine-4-carboxylate |
| SMILES | CCOC(=O)c1c(OC(F)(F)F)cnc(C(F)(F)F)c1CN |
| InChI | InChI=1S/C11H10F6N2O3/c1-2-21-9(20)7-5(3-18)8(10(12,13)14)19-4-6(7)22-11(15,16)17/h4H,2-3,18H2,1H3 |
| InChIKey | XTSJPPRYTSUELZ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.20 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |