C9H9F3N2O3 — CID 171028949
ethyl 4-amino-5-(trifluoromethoxy)pyridine-2-carboxylate (PubChem CID 171028949) has the molecular formula C9H9F3N2O3 and a molecular weight of 250.18 g/mol. Its IUPAC name is ethyl 4-amino-5-(trifluoromethoxy)pyridine-2-carboxylate.
| Compound Name | ethyl 4-amino-5-(trifluoromethoxy)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 171028949 |
| Molecular Formula | C9H9F3N2O3 |
| Molecular Weight | 250.18 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | ethyl 4-amino-5-(trifluoromethoxy)pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1cc(N)c(OC(F)(F)F)cn1 |
| InChI | InChI=1S/C9H9F3N2O3/c1-2-16-8(15)6-3-5(13)7(4-14-6)17-9(10,11)12/h3-4H,2H2,1H3,(H2,13,14) |
| InChIKey | IVUXBSPEOYZAIV-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.18 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |