C12H15F3N2O3 — CID 133085646
ethyl 2-[4-(aminomethyl)-3-methyl-5-(trifluoromethoxy)-2-pyridinyl]acetate (PubChem CID 133085646) has the molecular formula C12H15F3N2O3 and a molecular weight of 292.26 g/mol. Its IUPAC name is ethyl 2-[4-(aminomethyl)-3-methyl-5-(trifluoromethoxy)-2-pyridinyl]acetate.
| Compound Name | ethyl 2-[4-(aminomethyl)-3-methyl-5-(trifluoromethoxy)-2-pyridinyl]acetate |
|---|---|
| PubChem CID | 133085646 |
| Molecular Formula | C12H15F3N2O3 |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | ethyl 2-[4-(aminomethyl)-3-methyl-5-(trifluoromethoxy)-2-pyridinyl]acetate |
| SMILES | CCOC(=O)Cc1ncc(OC(F)(F)F)c(CN)c1C |
| InChI | InChI=1S/C12H15F3N2O3/c1-3-19-11(18)4-9-7(2)8(5-16)10(6-17-9)20-12(13,14)15/h6H,3-5,16H2,1-2H3 |
| InChIKey | SQPDKBZECVSARQ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |