C12H12F6N2O3 — CID 134678202
ethyl 2-[2-(aminomethyl)-3-(trifluoromethoxy)-5-(trifluoromethyl)-4-pyridinyl]acetate (PubChem CID 134678202) has the molecular formula C12H12F6N2O3 and a molecular weight of 346.23 g/mol. Its IUPAC name is ethyl 2-[2-(aminomethyl)-3-(trifluoromethoxy)-5-(trifluoromethyl)-4-pyridinyl]acetate.
| Compound Name | ethyl 2-[2-(aminomethyl)-3-(trifluoromethoxy)-5-(trifluoromethyl)-4-pyridinyl]acetate |
|---|---|
| PubChem CID | 134678202 |
| Molecular Formula | C12H12F6N2O3 |
| Molecular Weight | 346.23 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | ethyl 2-[2-(aminomethyl)-3-(trifluoromethoxy)-5-(trifluoromethyl)-4-pyridinyl]acetate |
| SMILES | CCOC(=O)Cc1c(C(F)(F)F)cnc(CN)c1OC(F)(F)F |
| InChI | InChI=1S/C12H12F6N2O3/c1-2-22-9(21)3-6-7(11(13,14)15)5-20-8(4-19)10(6)23-12(16,17)18/h5H,2-4,19H2,1H3 |
| InChIKey | UIJSCURUAGTUPO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.23 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |