C12H15F3N2O4 — CID 134660470
ethyl 2-[6-(aminomethyl)-5-methoxy-4-(trifluoromethoxy)-3-pyridinyl]acetate (PubChem CID 134660470) has the molecular formula C12H15F3N2O4 and a molecular weight of 308.26 g/mol. Its IUPAC name is ethyl 2-[6-(aminomethyl)-5-methoxy-4-(trifluoromethoxy)-3-pyridinyl]acetate.
| Compound Name | ethyl 2-[6-(aminomethyl)-5-methoxy-4-(trifluoromethoxy)-3-pyridinyl]acetate |
|---|---|
| PubChem CID | 134660470 |
| Molecular Formula | C12H15F3N2O4 |
| Molecular Weight | 308.26 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | ethyl 2-[6-(aminomethyl)-5-methoxy-4-(trifluoromethoxy)-3-pyridinyl]acetate |
| SMILES | CCOC(=O)Cc1cnc(CN)c(OC)c1OC(F)(F)F |
| InChI | InChI=1S/C12H15F3N2O4/c1-3-20-9(18)4-7-6-17-8(5-16)11(19-2)10(7)21-12(13,14)15/h6H,3-5,16H2,1-2H3 |
| InChIKey | ZWYXLDPZVAYBML-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 83.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.26 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |