C11H12F3NO5 — CID 134659556
ethyl 2-[5-hydroxy-4-methoxy-6-(trifluoromethoxy)-3-pyridinyl]acetate (PubChem CID 134659556) has the molecular formula C11H12F3NO5 and a molecular weight of 295.21 g/mol. Its IUPAC name is ethyl 2-[5-hydroxy-4-methoxy-6-(trifluoromethoxy)-3-pyridinyl]acetate.
| Compound Name | ethyl 2-[5-hydroxy-4-methoxy-6-(trifluoromethoxy)-3-pyridinyl]acetate |
|---|---|
| PubChem CID | 134659556 |
| Molecular Formula | C11H12F3NO5 |
| Molecular Weight | 295.21 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | ethyl 2-[5-hydroxy-4-methoxy-6-(trifluoromethoxy)-3-pyridinyl]acetate |
| SMILES | CCOC(=O)Cc1cnc(OC(F)(F)F)c(O)c1OC |
| InChI | InChI=1S/C11H12F3NO5/c1-3-19-7(16)4-6-5-15-10(20-11(12,13)14)8(17)9(6)18-2/h5,17H,3-4H2,1-2H3 |
| InChIKey | ORHNRCXGNKUDJZ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.21 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |