C8H5F3N2O6 — CID 134681270
2-[3-hydroxy-5-nitro-4-(trifluoromethoxy)-2-pyridinyl]acetic acid (PubChem CID 134681270) has the molecular formula C8H5F3N2O6 and a molecular weight of 282.13 g/mol. Its IUPAC name is 2-[3-hydroxy-5-nitro-4-(trifluoromethoxy)-2-pyridinyl]acetic acid.
| Compound Name | 2-[3-hydroxy-5-nitro-4-(trifluoromethoxy)-2-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 134681270 |
| Molecular Formula | C8H5F3N2O6 |
| Molecular Weight | 282.13 g/mol |
| Exact Mass | 282.01 |
| IUPAC Name | 2-[3-hydroxy-5-nitro-4-(trifluoromethoxy)-2-pyridinyl]acetic acid |
| SMILES | O=C(O)Cc1ncc([N+](=O)[O-])c(OC(F)(F)F)c1O |
| InChI | InChI=1S/C8H5F3N2O6/c9-8(10,11)19-7-4(13(17)18)2-12-3(6(7)16)1-5(14)15/h2,16H,1H2,(H,14,15) |
| InChIKey | PKOOPFJMSUEPSK-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 122.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.13 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|