C9H5F5N2O4 — CID 118835156
2-[4-(difluoromethyl)-5-nitro-3-(trifluoromethyl)-2-pyridinyl]acetic acid (PubChem CID 118835156) has the molecular formula C9H5F5N2O4 and a molecular weight of 300.14 g/mol. Its IUPAC name is 2-[4-(difluoromethyl)-5-nitro-3-(trifluoromethyl)-2-pyridinyl]acetic acid.
| Compound Name | 2-[4-(difluoromethyl)-5-nitro-3-(trifluoromethyl)-2-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 118835156 |
| Molecular Formula | C9H5F5N2O4 |
| Molecular Weight | 300.14 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | 2-[4-(difluoromethyl)-5-nitro-3-(trifluoromethyl)-2-pyridinyl]acetic acid |
| SMILES | O=C(O)Cc1ncc([N+](=O)[O-])c(C(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C9H5F5N2O4/c10-8(11)6-4(16(19)20)2-15-3(1-5(17)18)7(6)9(12,13)14/h2,8H,1H2,(H,17,18) |
| InChIKey | MLZLPKSLZZKABO-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 93.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.14 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|