C9H7ClF5NO2 — CID 118855287
[2-(chloromethyl)-5-(difluoromethyl)-4-(trifluoromethoxy)-3-pyridinyl]methanol (PubChem CID 118855287) has the molecular formula C9H7ClF5NO2 and a molecular weight of 291.60 g/mol. Its IUPAC name is [2-(chloromethyl)-5-(difluoromethyl)-4-(trifluoromethoxy)-3-pyridinyl]methanol.
| Compound Name | [2-(chloromethyl)-5-(difluoromethyl)-4-(trifluoromethoxy)-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 118855287 |
| Molecular Formula | C9H7ClF5NO2 |
| Molecular Weight | 291.60 g/mol |
| Exact Mass | 291.01 |
| IUPAC Name | [2-(chloromethyl)-5-(difluoromethyl)-4-(trifluoromethoxy)-3-pyridinyl]methanol |
| SMILES | OCc1c(CCl)ncc(C(F)F)c1OC(F)(F)F |
| InChI | InChI=1S/C9H7ClF5NO2/c10-1-6-5(3-17)7(18-9(13,14)15)4(2-16-6)8(11)12/h2,8,17H,1,3H2 |
| InChIKey | AQOOVZRNTFOEBT-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.60 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|