C8H4Cl2F5NO — CID 119020474
2-chloro-3-(chloromethyl)-5-(difluoromethyl)-4-(trifluoromethoxy)pyridine (PubChem CID 119020474) has the molecular formula C8H4Cl2F5NO and a molecular weight of 296.02 g/mol. Its IUPAC name is 2-chloro-3-(chloromethyl)-5-(difluoromethyl)-4-(trifluoromethoxy)pyridine.
| Compound Name | 2-chloro-3-(chloromethyl)-5-(difluoromethyl)-4-(trifluoromethoxy)pyridine |
|---|---|
| PubChem CID | 119020474 |
| Molecular Formula | C8H4Cl2F5NO |
| Molecular Weight | 296.02 g/mol |
| Exact Mass | 294.96 |
| IUPAC Name | 2-chloro-3-(chloromethyl)-5-(difluoromethyl)-4-(trifluoromethoxy)pyridine |
| SMILES | FC(F)c1cnc(Cl)c(CCl)c1OC(F)(F)F |
| InChI | InChI=1S/C8H4Cl2F5NO/c9-1-3-5(17-8(13,14)15)4(7(11)12)2-16-6(3)10/h2,7H,1H2 |
| InChIKey | WQFAFMUPRFUZAG-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.02 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|