C9H4ClF8NO — CID 134675956
3-(chloromethyl)-4-(difluoromethyl)-6-(trifluoromethoxy)-2-(trifluoromethyl)pyridine (PubChem CID 134675956) has the molecular formula C9H4ClF8NO and a molecular weight of 329.57 g/mol. Its IUPAC name is 3-(chloromethyl)-4-(difluoromethyl)-6-(trifluoromethoxy)-2-(trifluoromethyl)pyridine.
| Compound Name | 3-(chloromethyl)-4-(difluoromethyl)-6-(trifluoromethoxy)-2-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 134675956 |
| Molecular Formula | C9H4ClF8NO |
| Molecular Weight | 329.57 g/mol |
| Exact Mass | 328.99 |
| IUPAC Name | 3-(chloromethyl)-4-(difluoromethyl)-6-(trifluoromethoxy)-2-(trifluoromethyl)pyridine |
| SMILES | FC(F)c1cc(OC(F)(F)F)nc(C(F)(F)F)c1CCl |
| InChI | InChI=1S/C9H4ClF8NO/c10-2-4-3(7(11)12)1-5(20-9(16,17)18)19-6(4)8(13,14)15/h1,7H,2H2 |
| InChIKey | UHMJSQBLYFBGNB-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.57 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|