C10H4F5N3O — CID 119009167
3-(cyanomethyl)-4-(difluoromethyl)-6-(trifluoromethoxy)pyridine-2-carbonitrile (PubChem CID 119009167) has the molecular formula C10H4F5N3O and a molecular weight of 277.15 g/mol. Its IUPAC name is 3-(cyanomethyl)-4-(difluoromethyl)-6-(trifluoromethoxy)pyridine-2-carbonitrile.
| Compound Name | 3-(cyanomethyl)-4-(difluoromethyl)-6-(trifluoromethoxy)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 119009167 |
| Molecular Formula | C10H4F5N3O |
| Molecular Weight | 277.15 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | 3-(cyanomethyl)-4-(difluoromethyl)-6-(trifluoromethoxy)pyridine-2-carbonitrile |
| SMILES | N#CCc1c(C(F)F)cc(OC(F)(F)F)nc1C#N |
| InChI | InChI=1S/C10H4F5N3O/c11-9(12)6-3-8(19-10(13,14)15)18-7(4-17)5(6)1-2-16/h3,9H,1H2 |
| InChIKey | NPGXBVWVZKSCMK-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 69.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.15 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |