C10H5F5N2O3 — CID 119014377
2-[2-cyano-6-(difluoromethyl)-4-(trifluoromethoxy)-3-pyridinyl]acetic acid (PubChem CID 119014377) has the molecular formula C10H5F5N2O3 and a molecular weight of 296.15 g/mol. Its IUPAC name is 2-[2-cyano-6-(difluoromethyl)-4-(trifluoromethoxy)-3-pyridinyl]acetic acid.
| Compound Name | 2-[2-cyano-6-(difluoromethyl)-4-(trifluoromethoxy)-3-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 119014377 |
| Molecular Formula | C10H5F5N2O3 |
| Molecular Weight | 296.15 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | 2-[2-cyano-6-(difluoromethyl)-4-(trifluoromethoxy)-3-pyridinyl]acetic acid |
| SMILES | N#Cc1nc(C(F)F)cc(OC(F)(F)F)c1CC(=O)O |
| InChI | InChI=1S/C10H5F5N2O3/c11-9(12)5-2-7(20-10(13,14)15)4(1-8(18)19)6(3-16)17-5/h2,9H,1H2,(H,18,19) |
| InChIKey | IQFITJFBRBXJJD-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 83.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.15 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |