C11H7F5N2O2 — CID 133106141
methyl 2-[2-cyano-6-(difluoromethyl)-3-(trifluoromethyl)-4-pyridinyl]acetate (PubChem CID 133106141) has the molecular formula C11H7F5N2O2 and a molecular weight of 294.18 g/mol. Its IUPAC name is methyl 2-[2-cyano-6-(difluoromethyl)-3-(trifluoromethyl)-4-pyridinyl]acetate.
| Compound Name | methyl 2-[2-cyano-6-(difluoromethyl)-3-(trifluoromethyl)-4-pyridinyl]acetate |
|---|---|
| PubChem CID | 133106141 |
| Molecular Formula | C11H7F5N2O2 |
| Molecular Weight | 294.18 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | methyl 2-[2-cyano-6-(difluoromethyl)-3-(trifluoromethyl)-4-pyridinyl]acetate |
| SMILES | COC(=O)Cc1cc(C(F)F)nc(C#N)c1C(F)(F)F |
| InChI | InChI=1S/C11H7F5N2O2/c1-20-8(19)3-5-2-6(10(12)13)18-7(4-17)9(5)11(14,15)16/h2,10H,3H2,1H3 |
| InChIKey | WRZDQAWTSYENCY-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.18 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |