C12H12F2N2O2 — CID 134684145
ethyl 2-[2-cyano-6-(difluoromethyl)-3-methyl-4-pyridinyl]acetate (PubChem CID 134684145) has the molecular formula C12H12F2N2O2 and a molecular weight of 254.24 g/mol. Its IUPAC name is ethyl 2-[2-cyano-6-(difluoromethyl)-3-methyl-4-pyridinyl]acetate.
| Compound Name | ethyl 2-[2-cyano-6-(difluoromethyl)-3-methyl-4-pyridinyl]acetate |
|---|---|
| PubChem CID | 134684145 |
| Molecular Formula | C12H12F2N2O2 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | ethyl 2-[2-cyano-6-(difluoromethyl)-3-methyl-4-pyridinyl]acetate |
| SMILES | CCOC(=O)Cc1cc(C(F)F)nc(C#N)c1C |
| InChI | InChI=1S/C12H12F2N2O2/c1-3-18-11(17)5-8-4-9(12(13)14)16-10(6-15)7(8)2/h4,12H,3,5H2,1-2H3 |
| InChIKey | SYEGTZTZBBUDBM-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |