C12H11BrF2N2O2 — CID 133106708
ethyl 2-[2-(bromomethyl)-3-cyano-6-(difluoromethyl)-4-pyridinyl]acetate (PubChem CID 133106708) has the molecular formula C12H11BrF2N2O2 and a molecular weight of 333.13 g/mol. Its IUPAC name is ethyl 2-[2-(bromomethyl)-3-cyano-6-(difluoromethyl)-4-pyridinyl]acetate.
| Compound Name | ethyl 2-[2-(bromomethyl)-3-cyano-6-(difluoromethyl)-4-pyridinyl]acetate |
|---|---|
| PubChem CID | 133106708 |
| Molecular Formula | C12H11BrF2N2O2 |
| Molecular Weight | 333.13 g/mol |
| Exact Mass | 332.00 |
| IUPAC Name | ethyl 2-[2-(bromomethyl)-3-cyano-6-(difluoromethyl)-4-pyridinyl]acetate |
| SMILES | CCOC(=O)Cc1cc(C(F)F)nc(CBr)c1C#N |
| InChI | InChI=1S/C12H11BrF2N2O2/c1-2-19-11(18)4-7-3-9(12(14)15)17-10(5-13)8(7)6-16/h3,12H,2,4-5H2,1H3 |
| InChIKey | DEKUBEDBALXQNG-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.13 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|