C11H10F2N2O3 — CID 134686451
ethyl 2-[6-cyano-4-(difluoromethyl)-5-hydroxy-3-pyridinyl]acetate (PubChem CID 134686451) has the molecular formula C11H10F2N2O3 and a molecular weight of 256.21 g/mol. Its IUPAC name is ethyl 2-[6-cyano-4-(difluoromethyl)-5-hydroxy-3-pyridinyl]acetate.
| Compound Name | ethyl 2-[6-cyano-4-(difluoromethyl)-5-hydroxy-3-pyridinyl]acetate |
|---|---|
| PubChem CID | 134686451 |
| Molecular Formula | C11H10F2N2O3 |
| Molecular Weight | 256.21 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | ethyl 2-[6-cyano-4-(difluoromethyl)-5-hydroxy-3-pyridinyl]acetate |
| SMILES | CCOC(=O)Cc1cnc(C#N)c(O)c1C(F)F |
| InChI | InChI=1S/C11H10F2N2O3/c1-2-18-8(16)3-6-5-15-7(4-14)10(17)9(6)11(12)13/h5,11,17H,2-3H2,1H3 |
| InChIKey | QXCWKSHOJIKOGQ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 83.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.21 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |