C10H8F5NO2 — CID 171029487
methyl 2-[6-(difluoromethyl)-4-(trifluoromethyl)-2-pyridinyl]acetate (PubChem CID 171029487) has the molecular formula C10H8F5NO2 and a molecular weight of 269.17 g/mol. Its IUPAC name is methyl 2-[6-(difluoromethyl)-4-(trifluoromethyl)-2-pyridinyl]acetate.
| Compound Name | methyl 2-[6-(difluoromethyl)-4-(trifluoromethyl)-2-pyridinyl]acetate |
|---|---|
| PubChem CID | 171029487 |
| Molecular Formula | C10H8F5NO2 |
| Molecular Weight | 269.17 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | methyl 2-[6-(difluoromethyl)-4-(trifluoromethyl)-2-pyridinyl]acetate |
| SMILES | COC(=O)Cc1cc(C(F)(F)F)cc(C(F)F)n1 |
| InChI | InChI=1S/C10H8F5NO2/c1-18-8(17)4-6-2-5(10(13,14)15)3-7(16-6)9(11)12/h2-3,9H,4H2,1H3 |
| InChIKey | LEDAGXFSMYNSQB-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.17 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |