C11H11F5N2O2 — CID 133084710
methyl 2-[3-(aminomethyl)-6-(difluoromethyl)-4-(trifluoromethyl)-2-pyridinyl]acetate (PubChem CID 133084710) has the molecular formula C11H11F5N2O2 and a molecular weight of 298.21 g/mol. Its IUPAC name is methyl 2-[3-(aminomethyl)-6-(difluoromethyl)-4-(trifluoromethyl)-2-pyridinyl]acetate.
| Compound Name | methyl 2-[3-(aminomethyl)-6-(difluoromethyl)-4-(trifluoromethyl)-2-pyridinyl]acetate |
|---|---|
| PubChem CID | 133084710 |
| Molecular Formula | C11H11F5N2O2 |
| Molecular Weight | 298.21 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | methyl 2-[3-(aminomethyl)-6-(difluoromethyl)-4-(trifluoromethyl)-2-pyridinyl]acetate |
| SMILES | COC(=O)Cc1nc(C(F)F)cc(C(F)(F)F)c1CN |
| InChI | InChI=1S/C11H11F5N2O2/c1-20-9(19)3-7-5(4-17)6(11(14,15)16)2-8(18-7)10(12)13/h2,10H,3-4,17H2,1H3 |
| InChIKey | UBLOORQPQKJFBN-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.21 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |