C11H14F2N2O2 — CID 133084326
methyl 2-[3-(aminomethyl)-6-(difluoromethyl)-4-methyl-2-pyridinyl]acetate (PubChem CID 133084326) has the molecular formula C11H14F2N2O2 and a molecular weight of 244.24 g/mol. Its IUPAC name is methyl 2-[3-(aminomethyl)-6-(difluoromethyl)-4-methyl-2-pyridinyl]acetate.
| Compound Name | methyl 2-[3-(aminomethyl)-6-(difluoromethyl)-4-methyl-2-pyridinyl]acetate |
|---|---|
| PubChem CID | 133084326 |
| Molecular Formula | C11H14F2N2O2 |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | methyl 2-[3-(aminomethyl)-6-(difluoromethyl)-4-methyl-2-pyridinyl]acetate |
| SMILES | COC(=O)Cc1nc(C(F)F)cc(C)c1CN |
| InChI | InChI=1S/C11H14F2N2O2/c1-6-3-9(11(12)13)15-8(7(6)5-14)4-10(16)17-2/h3,11H,4-5,14H2,1-2H3 |
| InChIKey | XKAZEKAUHXPABZ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |