C9H4BrF5N2O — CID 118990969
2-[2-bromo-5-(difluoromethyl)-4-(trifluoromethoxy)-3-pyridinyl]acetonitrile (PubChem CID 118990969) has the molecular formula C9H4BrF5N2O and a molecular weight of 331.04 g/mol. Its IUPAC name is 2-[2-bromo-5-(difluoromethyl)-4-(trifluoromethoxy)-3-pyridinyl]acetonitrile.
| Compound Name | 2-[2-bromo-5-(difluoromethyl)-4-(trifluoromethoxy)-3-pyridinyl]acetonitrile |
|---|---|
| PubChem CID | 118990969 |
| Molecular Formula | C9H4BrF5N2O |
| Molecular Weight | 331.04 g/mol |
| Exact Mass | 329.94 |
| IUPAC Name | 2-[2-bromo-5-(difluoromethyl)-4-(trifluoromethoxy)-3-pyridinyl]acetonitrile |
| SMILES | N#CCc1c(Br)ncc(C(F)F)c1OC(F)(F)F |
| InChI | InChI=1S/C9H4BrF5N2O/c10-7-4(1-2-16)6(18-9(13,14)15)5(3-17-7)8(11)12/h3,8H,1H2 |
| InChIKey | UQXAUKNLVKSASB-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.04 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|