C8H2F9NO — CID 134665522
4-(difluoromethyl)-3-fluoro-6-(trifluoromethoxy)-2-(trifluoromethyl)pyridine (PubChem CID 134665522) has the molecular formula C8H2F9NO and a molecular weight of 299.09 g/mol. Its IUPAC name is 4-(difluoromethyl)-3-fluoro-6-(trifluoromethoxy)-2-(trifluoromethyl)pyridine.
| Compound Name | 4-(difluoromethyl)-3-fluoro-6-(trifluoromethoxy)-2-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 134665522 |
| Molecular Formula | C8H2F9NO |
| Molecular Weight | 299.09 g/mol |
| Exact Mass | 299.00 |
| IUPAC Name | 4-(difluoromethyl)-3-fluoro-6-(trifluoromethoxy)-2-(trifluoromethyl)pyridine |
| SMILES | Fc1c(C(F)F)cc(OC(F)(F)F)nc1C(F)(F)F |
| InChI | InChI=1S/C8H2F9NO/c9-4-2(6(10)11)1-3(19-8(15,16)17)18-5(4)7(12,13)14/h1,6H |
| InChIKey | MYNGPXFHSLETJW-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.09 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |