C7H4ClF5N2O — CID 118812417
2-chloro-5-(difluoromethyl)-3-(trifluoromethoxy)pyridin-4-amine (PubChem CID 118812417) has the molecular formula C7H4ClF5N2O and a molecular weight of 262.56 g/mol. Its IUPAC name is 2-chloro-5-(difluoromethyl)-3-(trifluoromethoxy)pyridin-4-amine.
| Compound Name | 2-chloro-5-(difluoromethyl)-3-(trifluoromethoxy)pyridin-4-amine |
|---|---|
| PubChem CID | 118812417 |
| Molecular Formula | C7H4ClF5N2O |
| Molecular Weight | 262.56 g/mol |
| Exact Mass | 261.99 |
| IUPAC Name | 2-chloro-5-(difluoromethyl)-3-(trifluoromethoxy)pyridin-4-amine |
| SMILES | Nc1c(C(F)F)cnc(Cl)c1OC(F)(F)F |
| InChI | InChI=1S/C7H4ClF5N2O/c8-5-4(16-7(11,12)13)3(14)2(1-15-5)6(9)10/h1,6H,(H2,14,15) |
| InChIKey | VDYVVLUSXIPQNW-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.56 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|