C7H5F5N2O2 — CID 118817785
4-amino-5-(difluoromethyl)-3-(trifluoromethoxy)-1H-pyridin-2-one (PubChem CID 118817785) has the molecular formula C7H5F5N2O2 and a molecular weight of 244.12 g/mol. Its IUPAC name is 4-amino-5-(difluoromethyl)-3-(trifluoromethoxy)-1H-pyridin-2-one.
| Compound Name | 4-amino-5-(difluoromethyl)-3-(trifluoromethoxy)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 118817785 |
| Molecular Formula | C7H5F5N2O2 |
| Molecular Weight | 244.12 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | 4-amino-5-(difluoromethyl)-3-(trifluoromethoxy)-1H-pyridin-2-one |
| SMILES | Nc1c(C(F)F)c[nH]c(=O)c1OC(F)(F)F |
| InChI | InChI=1S/C7H5F5N2O2/c8-5(9)2-1-14-6(15)4(3(2)13)16-7(10,11)12/h1,5H,(H3,13,14,15) |
| InChIKey | WHEVOCJXYTWPCS-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 68.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.12 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |