C7H5F2N3O — CID 130103221
3-amino-5-(difluoromethyl)-2-oxo-1H-pyridine-4-carbonitrile (PubChem CID 130103221) has the molecular formula C7H5F2N3O and a molecular weight of 185.13 g/mol. Its IUPAC name is 3-amino-5-(difluoromethyl)-2-oxo-1H-pyridine-4-carbonitrile.
| Compound Name | 3-amino-5-(difluoromethyl)-2-oxo-1H-pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 130103221 |
| Molecular Formula | C7H5F2N3O |
| Molecular Weight | 185.13 g/mol |
| Exact Mass | 185.04 |
| IUPAC Name | 3-amino-5-(difluoromethyl)-2-oxo-1H-pyridine-4-carbonitrile |
| SMILES | N#Cc1c(C(F)F)c[nH]c(=O)c1N |
| InChI | InChI=1S/C7H5F2N3O/c8-6(9)4-2-12-7(13)5(11)3(4)1-10/h2,6H,11H2,(H,12,13) |
| InChIKey | UIMMUXHXLLSLJM-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 82.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.13 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |