C7H8F2N2O — CID 130104590
3-amino-5-(difluoromethyl)-4-methyl-1H-pyridin-2-one (PubChem CID 130104590) has the molecular formula C7H8F2N2O and a molecular weight of 174.15 g/mol. Its IUPAC name is 3-amino-5-(difluoromethyl)-4-methyl-1H-pyridin-2-one.
| Compound Name | 3-amino-5-(difluoromethyl)-4-methyl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 130104590 |
| Molecular Formula | C7H8F2N2O |
| Molecular Weight | 174.15 g/mol |
| Exact Mass | 174.06 |
| IUPAC Name | 3-amino-5-(difluoromethyl)-4-methyl-1H-pyridin-2-one |
| SMILES | Cc1c(C(F)F)c[nH]c(=O)c1N |
| InChI | InChI=1S/C7H8F2N2O/c1-3-4(6(8)9)2-11-7(12)5(3)10/h2,6H,10H2,1H3,(H,11,12) |
| InChIKey | VDWCGPKCDBJOQN-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.15 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |