C6H5F2NO3 — CID 130088807
5-(difluoromethyl)-3,4-dihydroxy-1H-pyridin-2-one (PubChem CID 130088807) has the molecular formula C6H5F2NO3 and a molecular weight of 177.11 g/mol. Its IUPAC name is 5-(difluoromethyl)-3,4-dihydroxy-1H-pyridin-2-one.
| Compound Name | 5-(difluoromethyl)-3,4-dihydroxy-1H-pyridin-2-one |
|---|---|
| PubChem CID | 130088807 |
| Molecular Formula | C6H5F2NO3 |
| Molecular Weight | 177.11 g/mol |
| Exact Mass | 177.02 |
| IUPAC Name | 5-(difluoromethyl)-3,4-dihydroxy-1H-pyridin-2-one |
| SMILES | O=c1[nH]cc(C(F)F)c(O)c1O |
| InChI | InChI=1S/C6H5F2NO3/c7-5(8)2-1-9-6(12)4(11)3(2)10/h1,5,11H,(H2,9,10,12) |
| InChIKey | QDVCAFGZAWUEJX-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.11 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |