C9H5F2N3O — CID 130076765
2-(cyanomethyl)-5-(difluoromethyl)-4-oxo-1H-pyridine-3-carbonitrile (PubChem CID 130076765) has the molecular formula C9H5F2N3O and a molecular weight of 209.16 g/mol. Its IUPAC name is 2-(cyanomethyl)-5-(difluoromethyl)-4-oxo-1H-pyridine-3-carbonitrile.
| Compound Name | 2-(cyanomethyl)-5-(difluoromethyl)-4-oxo-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 130076765 |
| Molecular Formula | C9H5F2N3O |
| Molecular Weight | 209.16 g/mol |
| Exact Mass | 209.04 |
| IUPAC Name | 2-(cyanomethyl)-5-(difluoromethyl)-4-oxo-1H-pyridine-3-carbonitrile |
| SMILES | N#CCc1[nH]cc(C(F)F)c(=O)c1C#N |
| InChI | InChI=1S/C9H5F2N3O/c10-9(11)6-4-14-7(1-2-12)5(3-13)8(6)15/h4,9H,1H2,(H,14,15) |
| InChIKey | PZCVCEUJBQZGCT-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.16 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |