C8H7ClF3NO3 — CID 118838341
2-(chloromethyl)-5-(hydroxymethyl)-4-(trifluoromethoxy)pyridin-3-ol (PubChem CID 118838341) has the molecular formula C8H7ClF3NO3 and a molecular weight of 257.59 g/mol. Its IUPAC name is 2-(chloromethyl)-5-(hydroxymethyl)-4-(trifluoromethoxy)pyridin-3-ol.
| Compound Name | 2-(chloromethyl)-5-(hydroxymethyl)-4-(trifluoromethoxy)pyridin-3-ol |
|---|---|
| PubChem CID | 118838341 |
| Molecular Formula | C8H7ClF3NO3 |
| Molecular Weight | 257.59 g/mol |
| Exact Mass | 257.01 |
| IUPAC Name | 2-(chloromethyl)-5-(hydroxymethyl)-4-(trifluoromethoxy)pyridin-3-ol |
| SMILES | OCc1cnc(CCl)c(O)c1OC(F)(F)F |
| InChI | InChI=1S/C8H7ClF3NO3/c9-1-5-6(15)7(16-8(10,11)12)4(3-14)2-13-5/h2,14-15H,1,3H2 |
| InChIKey | VSCUAUIPSJOMNF-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.59 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|