C8H6F3IN2O3 — CID 134666863
4-(aminomethyl)-6-iodo-5-(trifluoromethoxy)pyridine-3-carboxylic acid (PubChem CID 134666863) has the molecular formula C8H6F3IN2O3 and a molecular weight of 362.05 g/mol. Its IUPAC name is 4-(aminomethyl)-6-iodo-5-(trifluoromethoxy)pyridine-3-carboxylic acid.
| Compound Name | 4-(aminomethyl)-6-iodo-5-(trifluoromethoxy)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 134666863 |
| Molecular Formula | C8H6F3IN2O3 |
| Molecular Weight | 362.05 g/mol |
| Exact Mass | 361.94 |
| IUPAC Name | 4-(aminomethyl)-6-iodo-5-(trifluoromethoxy)pyridine-3-carboxylic acid |
| SMILES | NCc1c(C(=O)O)cnc(I)c1OC(F)(F)F |
| InChI | InChI=1S/C8H6F3IN2O3/c9-8(10,11)17-5-3(1-13)4(7(15)16)2-14-6(5)12/h2H,1,13H2,(H,15,16) |
| InChIKey | JMSWEHNDKYELHL-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.05 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|