C12H10ClF6NO3 — CID 134665355
ethyl 2-[5-(chloromethyl)-4-(trifluoromethoxy)-3-(trifluoromethyl)-2-pyridinyl]acetate (PubChem CID 134665355) has the molecular formula C12H10ClF6NO3 and a molecular weight of 365.66 g/mol. Its IUPAC name is ethyl 2-[5-(chloromethyl)-4-(trifluoromethoxy)-3-(trifluoromethyl)-2-pyridinyl]acetate.
| Compound Name | ethyl 2-[5-(chloromethyl)-4-(trifluoromethoxy)-3-(trifluoromethyl)-2-pyridinyl]acetate |
|---|---|
| PubChem CID | 134665355 |
| Molecular Formula | C12H10ClF6NO3 |
| Molecular Weight | 365.66 g/mol |
| Exact Mass | 365.03 |
| IUPAC Name | ethyl 2-[5-(chloromethyl)-4-(trifluoromethoxy)-3-(trifluoromethyl)-2-pyridinyl]acetate |
| SMILES | CCOC(=O)Cc1ncc(CCl)c(OC(F)(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C12H10ClF6NO3/c1-2-22-8(21)3-7-9(11(14,15)16)10(23-12(17,18)19)6(4-13)5-20-7/h5H,2-4H2,1H3 |
| InChIKey | RUHQUYYNCXIWOR-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.66 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|