C8H3ClF7NO — CID 134658888
5-(chloromethyl)-2-fluoro-4-(trifluoromethoxy)-3-(trifluoromethyl)pyridine (PubChem CID 134658888) has the molecular formula C8H3ClF7NO and a molecular weight of 297.56 g/mol. Its IUPAC name is 5-(chloromethyl)-2-fluoro-4-(trifluoromethoxy)-3-(trifluoromethyl)pyridine.
| Compound Name | 5-(chloromethyl)-2-fluoro-4-(trifluoromethoxy)-3-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 134658888 |
| Molecular Formula | C8H3ClF7NO |
| Molecular Weight | 297.56 g/mol |
| Exact Mass | 296.98 |
| IUPAC Name | 5-(chloromethyl)-2-fluoro-4-(trifluoromethoxy)-3-(trifluoromethyl)pyridine |
| SMILES | Fc1ncc(CCl)c(OC(F)(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C8H3ClF7NO/c9-1-3-2-17-6(10)4(7(11,12)13)5(3)18-8(14,15)16/h2H,1H2 |
| InChIKey | PQVCLXHQSDIRBB-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.56 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|