C8H6ClF5N2O — CID 119007700
5-(chloromethyl)-3-(difluoromethyl)-4-(trifluoromethoxy)pyridin-2-amine (PubChem CID 119007700) has the molecular formula C8H6ClF5N2O and a molecular weight of 276.59 g/mol. Its IUPAC name is 5-(chloromethyl)-3-(difluoromethyl)-4-(trifluoromethoxy)pyridin-2-amine.
| Compound Name | 5-(chloromethyl)-3-(difluoromethyl)-4-(trifluoromethoxy)pyridin-2-amine |
|---|---|
| PubChem CID | 119007700 |
| Molecular Formula | C8H6ClF5N2O |
| Molecular Weight | 276.59 g/mol |
| Exact Mass | 276.01 |
| IUPAC Name | 5-(chloromethyl)-3-(difluoromethyl)-4-(trifluoromethoxy)pyridin-2-amine |
| SMILES | Nc1ncc(CCl)c(OC(F)(F)F)c1C(F)F |
| InChI | InChI=1S/C8H6ClF5N2O/c9-1-3-2-16-7(15)4(6(10)11)5(3)17-8(12,13)14/h2,6H,1H2,(H2,15,16) |
| InChIKey | JTGFFKQSADURDC-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.59 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|