C7H5F5N2O2 — CID 119014102
6-amino-4-(difluoromethyl)-5-(trifluoromethoxy)pyridin-3-ol (PubChem CID 119014102) has the molecular formula C7H5F5N2O2 and a molecular weight of 244.12 g/mol. Its IUPAC name is 6-amino-4-(difluoromethyl)-5-(trifluoromethoxy)pyridin-3-ol.
| Compound Name | 6-amino-4-(difluoromethyl)-5-(trifluoromethoxy)pyridin-3-ol |
|---|---|
| PubChem CID | 119014102 |
| Molecular Formula | C7H5F5N2O2 |
| Molecular Weight | 244.12 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | 6-amino-4-(difluoromethyl)-5-(trifluoromethoxy)pyridin-3-ol |
| SMILES | Nc1ncc(O)c(C(F)F)c1OC(F)(F)F |
| InChI | InChI=1S/C7H5F5N2O2/c8-5(9)3-2(15)1-14-6(13)4(3)16-7(10,11)12/h1,5,15H,(H2,13,14) |
| InChIKey | KODSGRGZAQWGFJ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 68.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.12 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |