C7H5F5N2O — CID 118993704
2-amino-4-(difluoromethyl)-5-(trifluoromethyl)pyridin-3-ol (PubChem CID 118993704) has the molecular formula C7H5F5N2O and a molecular weight of 228.12 g/mol. Its IUPAC name is 2-amino-4-(difluoromethyl)-5-(trifluoromethyl)pyridin-3-ol.
| Compound Name | 2-amino-4-(difluoromethyl)-5-(trifluoromethyl)pyridin-3-ol |
|---|---|
| PubChem CID | 118993704 |
| Molecular Formula | C7H5F5N2O |
| Molecular Weight | 228.12 g/mol |
| Exact Mass | 228.03 |
| IUPAC Name | 2-amino-4-(difluoromethyl)-5-(trifluoromethyl)pyridin-3-ol |
| SMILES | Nc1ncc(C(F)(F)F)c(C(F)F)c1O |
| InChI | InChI=1S/C7H5F5N2O/c8-5(9)3-2(7(10,11)12)1-14-6(13)4(3)15/h1,5,15H,(H2,13,14) |
| InChIKey | LDEFGQGEPHUCRQ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.12 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |