C8H6ClF5N2 — CID 119011225
4-(chloromethyl)-3-(difluoromethyl)-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 119011225) has the molecular formula C8H6ClF5N2 and a molecular weight of 260.59 g/mol. Its IUPAC name is 4-(chloromethyl)-3-(difluoromethyl)-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 4-(chloromethyl)-3-(difluoromethyl)-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 119011225 |
| Molecular Formula | C8H6ClF5N2 |
| Molecular Weight | 260.59 g/mol |
| Exact Mass | 260.01 |
| IUPAC Name | 4-(chloromethyl)-3-(difluoromethyl)-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | Nc1ncc(C(F)(F)F)c(CCl)c1C(F)F |
| InChI | InChI=1S/C8H6ClF5N2/c9-1-3-4(8(12,13)14)2-16-7(15)5(3)6(10)11/h2,6H,1H2,(H2,15,16) |
| InChIKey | KLGOCPYWJKZJOJ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.59 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|