C8H5F5N2O2 — CID 118990891
2-amino-4-(difluoromethyl)-5-(trifluoromethyl)pyridine-3-carboxylic acid (PubChem CID 118990891) has the molecular formula C8H5F5N2O2 and a molecular weight of 256.13 g/mol. Its IUPAC name is 2-amino-4-(difluoromethyl)-5-(trifluoromethyl)pyridine-3-carboxylic acid.
| Compound Name | 2-amino-4-(difluoromethyl)-5-(trifluoromethyl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 118990891 |
| Molecular Formula | C8H5F5N2O2 |
| Molecular Weight | 256.13 g/mol |
| Exact Mass | 256.03 |
| IUPAC Name | 2-amino-4-(difluoromethyl)-5-(trifluoromethyl)pyridine-3-carboxylic acid |
| SMILES | Nc1ncc(C(F)(F)F)c(C(F)F)c1C(=O)O |
| InChI | InChI=1S/C8H5F5N2O2/c9-5(10)3-2(8(11,12)13)1-15-6(14)4(3)7(16)17/h1,5H,(H2,14,15)(H,16,17) |
| InChIKey | PBLFWVRCWAXJFF-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.13 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |