C9H6BrF5N2O — CID 118838272
2-(bromomethyl)-4-(difluoromethyl)-5-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 118838272) has the molecular formula C9H6BrF5N2O and a molecular weight of 333.05 g/mol. Its IUPAC name is 2-(bromomethyl)-4-(difluoromethyl)-5-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | 2-(bromomethyl)-4-(difluoromethyl)-5-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 118838272 |
| Molecular Formula | C9H6BrF5N2O |
| Molecular Weight | 333.05 g/mol |
| Exact Mass | 331.96 |
| IUPAC Name | 2-(bromomethyl)-4-(difluoromethyl)-5-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | NC(=O)c1c(CBr)ncc(C(F)(F)F)c1C(F)F |
| InChI | InChI=1S/C9H6BrF5N2O/c10-1-4-6(8(16)18)5(7(11)12)3(2-17-4)9(13,14)15/h2,7H,1H2,(H2,16,18) |
| InChIKey | QSQMYTBBZMODJO-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.05 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|