C10H6BrF5N2 — CID 118849533
2-[2-(bromomethyl)-4-(difluoromethyl)-5-(trifluoromethyl)-3-pyridinyl]acetonitrile (PubChem CID 118849533) has the molecular formula C10H6BrF5N2 and a molecular weight of 329.07 g/mol. Its IUPAC name is 2-[2-(bromomethyl)-4-(difluoromethyl)-5-(trifluoromethyl)-3-pyridinyl]acetonitrile.
| Compound Name | 2-[2-(bromomethyl)-4-(difluoromethyl)-5-(trifluoromethyl)-3-pyridinyl]acetonitrile |
|---|---|
| PubChem CID | 118849533 |
| Molecular Formula | C10H6BrF5N2 |
| Molecular Weight | 329.07 g/mol |
| Exact Mass | 327.96 |
| IUPAC Name | 2-[2-(bromomethyl)-4-(difluoromethyl)-5-(trifluoromethyl)-3-pyridinyl]acetonitrile |
| SMILES | N#CCc1c(CBr)ncc(C(F)(F)F)c1C(F)F |
| InChI | InChI=1S/C10H6BrF5N2/c11-3-7-5(1-2-17)8(9(12)13)6(4-18-7)10(14,15)16/h4,9H,1,3H2 |
| InChIKey | IIEYSPNWODLPSE-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.07 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|