C9H6F5N3 — CID 118812030
2-[4-amino-3-(difluoromethyl)-5-(trifluoromethyl)-2-pyridinyl]acetonitrile (PubChem CID 118812030) has the molecular formula C9H6F5N3 and a molecular weight of 251.16 g/mol. Its IUPAC name is 2-[4-amino-3-(difluoromethyl)-5-(trifluoromethyl)-2-pyridinyl]acetonitrile.
| Compound Name | 2-[4-amino-3-(difluoromethyl)-5-(trifluoromethyl)-2-pyridinyl]acetonitrile |
|---|---|
| PubChem CID | 118812030 |
| Molecular Formula | C9H6F5N3 |
| Molecular Weight | 251.16 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | 2-[4-amino-3-(difluoromethyl)-5-(trifluoromethyl)-2-pyridinyl]acetonitrile |
| SMILES | N#CCc1ncc(C(F)(F)F)c(N)c1C(F)F |
| InChI | InChI=1S/C9H6F5N3/c10-8(11)6-5(1-2-15)17-3-4(7(6)16)9(12,13)14/h3,8H,1H2,(H2,16,17) |
| InChIKey | BJIPRTNBMODFEH-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.16 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |