C8H6F3N3 — CID 118811281
2-[4-amino-3-(difluoromethyl)-5-fluoro-2-pyridinyl]acetonitrile (PubChem CID 118811281) has the molecular formula C8H6F3N3 and a molecular weight of 201.15 g/mol. Its IUPAC name is 2-[4-amino-3-(difluoromethyl)-5-fluoro-2-pyridinyl]acetonitrile.
| Compound Name | 2-[4-amino-3-(difluoromethyl)-5-fluoro-2-pyridinyl]acetonitrile |
|---|---|
| PubChem CID | 118811281 |
| Molecular Formula | C8H6F3N3 |
| Molecular Weight | 201.15 g/mol |
| Exact Mass | 201.05 |
| IUPAC Name | 2-[4-amino-3-(difluoromethyl)-5-fluoro-2-pyridinyl]acetonitrile |
| SMILES | N#CCc1ncc(F)c(N)c1C(F)F |
| InChI | InChI=1S/C8H6F3N3/c9-4-3-14-5(1-2-12)6(7(4)13)8(10)11/h3,8H,1H2,(H2,13,14) |
| InChIKey | YXNTWNPICKLNDC-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.15 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |