C9H8ClF2N3 — CID 130074972
2-[4-(aminomethyl)-5-chloro-3-(difluoromethyl)-2-pyridinyl]acetonitrile (PubChem CID 130074972) has the molecular formula C9H8ClF2N3 and a molecular weight of 231.63 g/mol. Its IUPAC name is 2-[4-(aminomethyl)-5-chloro-3-(difluoromethyl)-2-pyridinyl]acetonitrile.
| Compound Name | 2-[4-(aminomethyl)-5-chloro-3-(difluoromethyl)-2-pyridinyl]acetonitrile |
|---|---|
| PubChem CID | 130074972 |
| Molecular Formula | C9H8ClF2N3 |
| Molecular Weight | 231.63 g/mol |
| Exact Mass | 231.04 |
| IUPAC Name | 2-[4-(aminomethyl)-5-chloro-3-(difluoromethyl)-2-pyridinyl]acetonitrile |
| SMILES | N#CCc1ncc(Cl)c(CN)c1C(F)F |
| InChI | InChI=1S/C9H8ClF2N3/c10-6-4-15-7(1-2-13)8(9(11)12)5(6)3-14/h4,9H,1,3,14H2 |
| InChIKey | JQBGZPZNUSPLKV-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.63 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |