C10H9ClF2N2 — CID 130090393
2-[4-(chloromethyl)-3-(difluoromethyl)-5-methyl-2-pyridinyl]acetonitrile (PubChem CID 130090393) has the molecular formula C10H9ClF2N2 and a molecular weight of 230.64 g/mol. Its IUPAC name is 2-[4-(chloromethyl)-3-(difluoromethyl)-5-methyl-2-pyridinyl]acetonitrile.
| Compound Name | 2-[4-(chloromethyl)-3-(difluoromethyl)-5-methyl-2-pyridinyl]acetonitrile |
|---|---|
| PubChem CID | 130090393 |
| Molecular Formula | C10H9ClF2N2 |
| Molecular Weight | 230.64 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | 2-[4-(chloromethyl)-3-(difluoromethyl)-5-methyl-2-pyridinyl]acetonitrile |
| SMILES | Cc1cnc(CC#N)c(C(F)F)c1CCl |
| InChI | InChI=1S/C10H9ClF2N2/c1-6-5-15-8(2-3-14)9(10(12)13)7(6)4-11/h5,10H,2,4H2,1H3 |
| InChIKey | TZEOMVGJHHTQKW-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.64 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|