C10H6ClF5N2O — CID 134665144
2-[3-(chloromethyl)-4-(difluoromethyl)-5-(trifluoromethoxy)-2-pyridinyl]acetonitrile (PubChem CID 134665144) has the molecular formula C10H6ClF5N2O and a molecular weight of 300.61 g/mol. Its IUPAC name is 2-[3-(chloromethyl)-4-(difluoromethyl)-5-(trifluoromethoxy)-2-pyridinyl]acetonitrile.
| Compound Name | 2-[3-(chloromethyl)-4-(difluoromethyl)-5-(trifluoromethoxy)-2-pyridinyl]acetonitrile |
|---|---|
| PubChem CID | 134665144 |
| Molecular Formula | C10H6ClF5N2O |
| Molecular Weight | 300.61 g/mol |
| Exact Mass | 300.01 |
| IUPAC Name | 2-[3-(chloromethyl)-4-(difluoromethyl)-5-(trifluoromethoxy)-2-pyridinyl]acetonitrile |
| SMILES | N#CCc1ncc(OC(F)(F)F)c(C(F)F)c1CCl |
| InChI | InChI=1S/C10H6ClF5N2O/c11-3-5-6(1-2-17)18-4-7(8(5)9(12)13)19-10(14,15)16/h4,9H,1,3H2 |
| InChIKey | MKBJUKGGPJRLRK-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.61 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|